A precursor in the formation of terpenoids and steroids. It has the formula CH2OHCH2C(OH)(CH3)CH2COOH. Biosynthesis of gibberellins, cytokinins, and abscisic acid is from mevalonic acid. Certain growth retardants, e.g. Amo-1618 and CCC (chlorcholine chloride), are believed to act by blocking the step from geranylgeranylpyrophosphate to kaurene in the mevalonic acid synthesis pathway, so preventing gibberellin synthesis.
|